C19H20F4N2O2S — CID 171913966
2-[4-fluoro-3-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 171913966) has the molecular formula C19H20F4N2O2S and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 171913966 |
| Molecular Formula | C19H20F4N2O2S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CN1CCC(NS(=O)(=O)c2ccccc2-c2ccc(F)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H20F4N2O2S/c1-25-10-8-14(9-11-25)24-28(26,27)18-5-3-2-4-15(18)13-6-7-17(20)16(12-13)19(21,22)23/h2-7,12,14,24H,8-11H2,1H3 |
| InChIKey | MJEZBSZILZIXLH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |