C24H24N2O5 — CID 171914162
(1R,8R,9S)-8-(hydroxymethyl)-11-[2-(7-methyl-2-oxochromen-4-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 171914162) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is (1R,8R,9S)-8-(hydroxymethyl)-11-[2-(7-methyl-2-oxochromen-4-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8R,9S)-8-(hydroxymethyl)-11-[2-(7-methyl-2-oxochromen-4-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 171914162 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (1R,8R,9S)-8-(hydroxymethyl)-11-[2-(7-methyl-2-oxochromen-4-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1ccc2c(CC(=O)N3C[C@H]4C[C@@H](C3)[C@H](CO)n3c4cccc3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O5/c1-14-5-6-18-15(10-24(30)31-21(18)7-14)9-23(29)25-11-16-8-17(12-25)20(13-27)26-19(16)3-2-4-22(26)28/h2-7,10,16-17,20,27H,8-9,11-13H2,1H3/t16-,17+,20+/m1/s1 |
| InChIKey | WUZWHXWAZRTCPW-UWVAXJGDSA-N |
| XLogP | 1.98 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|