C19H21N3O3 — CID 171915187
[(3aS,6aS)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone (PubChem CID 171915187) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(3aS,6aS)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | [(3aS,6aS)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 171915187 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(3aS,6aS)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)methanone |
| SMILES | O=C(N1CCc2oc(-c3ccccc3)nc2C1)[C@]12CNC[C@H]1COC2 |
| InChI | InChI=1S/C19H21N3O3/c23-18(19-11-20-8-14(19)10-24-12-19)22-7-6-16-15(9-22)21-17(25-16)13-4-2-1-3-5-13/h1-5,14,20H,6-12H2/t14-,19-/m0/s1 |
| InChIKey | YLSMHRYXQMKAMV-LIRRHRJNSA-N |
| XLogP | 1.46 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |