C17H22N4O5S2 — CID 17191795
3,5-dimethoxy-N-[3-[[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]benzamide (PubChem CID 17191795) has the molecular formula C17H22N4O5S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[3-[[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[3-[[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 17191795 |
| Molecular Formula | C17H22N4O5S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3,5-dimethoxy-N-[3-[[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]benzamide |
| SMILES | COCCSc1nnc(NC(=O)CCNC(=O)c2cc(OC)cc(OC)c2)s1 |
| InChI | InChI=1S/C17H22N4O5S2/c1-24-6-7-27-17-21-20-16(28-17)19-14(22)4-5-18-15(23)11-8-12(25-2)10-13(9-11)26-3/h8-10H,4-7H2,1-3H3,(H,18,23)(H,19,20,22) |
| InChIKey | IXBHWONIRCHTDI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|