C17H16BN2O6- — CID 171918786
4-[4-(aminomethyl)benzoyl]imino-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylic acid (PubChem CID 171918786) has the molecular formula C17H16BN2O6- and a molecular weight of 355.14 g/mol. Its IUPAC name is 4-[4-(aminomethyl)benzoyl]imino-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylic acid.
| Compound Name | 4-[4-(aminomethyl)benzoyl]imino-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylic acid |
|---|---|
| PubChem CID | 171918786 |
| Molecular Formula | C17H16BN2O6- |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[4-(aminomethyl)benzoyl]imino-3,3-dihydroxy-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(6),7,9-triene-10-carboxylic acid |
| SMILES | NCc1ccc(C(=O)/N=C2\Cc3cccc(C(=O)O)c3O[B-]2(O)O)cc1 |
| InChI | InChI=1S/C17H16BN2O6/c19-9-10-4-6-11(7-5-10)16(21)20-14-8-12-2-1-3-13(17(22)23)15(12)26-18(14,24)25/h1-7,24-25H,8-9,19H2,(H,22,23)/q-1/b20-14+ |
| InChIKey | XVWSDBRDZNEJQZ-XSFVSMFZSA-N |
| XLogP | 0.52 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|