C14H14ClNO — CID 171920442
2-chloro-6-(3,5-dimethylanilino)phenol (PubChem CID 171920442) has the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. Its IUPAC name is 2-chloro-6-(3,5-dimethylanilino)phenol.
| Compound Name | 2-chloro-6-(3,5-dimethylanilino)phenol |
|---|---|
| PubChem CID | 171920442 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-chloro-6-(3,5-dimethylanilino)phenol |
| SMILES | Cc1cc(C)cc(Nc2cccc(Cl)c2O)c1 |
| InChI | InChI=1S/C14H14ClNO/c1-9-6-10(2)8-11(7-9)16-13-5-3-4-12(15)14(13)17/h3-8,16-17H,1-2H3 |
| InChIKey | BCIZBIPFQAYNPE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|