C12H16ClNO3 — CID 97246482
(3R)-N-(3-chloro-2-hydroxyphenyl)-3-hydroxy-4-methylpentanamide (PubChem CID 97246482) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is (3R)-N-(3-chloro-2-hydroxyphenyl)-3-hydroxy-4-methylpentanamide.
| Compound Name | (3R)-N-(3-chloro-2-hydroxyphenyl)-3-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 97246482 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (3R)-N-(3-chloro-2-hydroxyphenyl)-3-hydroxy-4-methylpentanamide |
| SMILES | CC(C)[C@H](O)CC(=O)Nc1cccc(Cl)c1O |
| InChI | InChI=1S/C12H16ClNO3/c1-7(2)10(15)6-11(16)14-9-5-3-4-8(13)12(9)17/h3-5,7,10,15,17H,6H2,1-2H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | CMZRULRXKHBISE-SNVBAGLBSA-N |
| XLogP | 2.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|