C33H41N3O5 — CID 171920627
[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] N,N-dihexylcarbamate (PubChem CID 171920627) has the molecular formula C33H41N3O5 and a molecular weight of 559.71 g/mol. Its IUPAC name is [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] N,N-dihexylcarbamate.
| Compound Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] N,N-dihexylcarbamate |
|---|---|
| PubChem CID | 171920627 |
| Molecular Formula | C33H41N3O5 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)O[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C33H41N3O5/c1-4-7-9-13-17-35(18-14-10-8-5-2)32(39)41-33(6-3)26-20-28-29-24(19-23-15-11-12-16-27(23)34-29)21-36(28)30(37)25(26)22-40-31(33)38/h11-12,15-16,19-20H,4-10,13-14,17-18,21-22H2,1-3H3/t33-/m0/s1 |
| InChIKey | XEEPGVHACQONBE-XIFFEERXSA-N |
| XLogP | 6.69 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|