C25H25ClN4O6 — CID 67041091
(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) (2S)-2-[acetyl(methyl)amino]-2-aminoacetate;hydrochloride (PubChem CID 67041091) has the molecular formula C25H25ClN4O6 and a molecular weight of 512.95 g/mol. Its IUPAC name is (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) (2S)-2-[acetyl(methyl)amino]-2-aminoacetate;hydrochloride.
| Compound Name | (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) (2S)-2-[acetyl(methyl)amino]-2-aminoacetate;hydrochloride |
|---|---|
| PubChem CID | 67041091 |
| Molecular Formula | C25H25ClN4O6 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) (2S)-2-[acetyl(methyl)amino]-2-aminoacetate;hydrochloride |
| SMILES | CCC1(OC(=O)[C@@H](N)N(C)C(C)=O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1.Cl |
| InChI | InChI=1S/C25H24N4O6.ClH/c1-4-25(35-23(32)21(26)28(3)13(2)30)17-10-19-20-15(9-14-7-5-6-8-18(14)27-20)11-29(19)22(31)16(17)12-34-24(25)33;/h5-10,21H,4,11-12,26H2,1-3H3;1H/t21-,25?;/m0./s1 |
| InChIKey | DIBVXNNXOBQYSZ-HVQOWYNLSA-N |
| XLogP | 1.82 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|