C28H29N3O7 — CID 58041479
4-O-tert-butyl 1-O-[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-aminobutanedioate (PubChem CID 58041479) has the molecular formula C28H29N3O7 and a molecular weight of 519.55 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-aminobutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-aminobutanedioate |
|---|---|
| PubChem CID | 58041479 |
| Molecular Formula | C28H29N3O7 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-aminobutanedioate |
| SMILES | CC[C@@]1(OC(=O)C(N)CC(=O)OC(C)(C)C)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C28H29N3O7/c1-5-28(38-25(34)19(29)12-22(32)37-27(2,3)4)18-11-21-23-16(10-15-8-6-7-9-20(15)30-23)13-31(21)24(33)17(18)14-36-26(28)35/h6-11,19H,5,12-14,29H2,1-4H3/t19?,28-/m0/s1 |
| InChIKey | OOPVRJKEYBMLLK-JEBGQCBNSA-N |
| XLogP | 2.69 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|