C10H9F2INO2- — CID 171922375
2-[4-(difluoromethyl)-5-ethyl-6-iodo-2-pyridinyl]acetate (PubChem CID 171922375) has the molecular formula C10H9F2INO2- and a molecular weight of 340.09 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-5-ethyl-6-iodo-2-pyridinyl]acetate.
| Compound Name | 2-[4-(difluoromethyl)-5-ethyl-6-iodo-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 171922375 |
| Molecular Formula | C10H9F2INO2- |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-[4-(difluoromethyl)-5-ethyl-6-iodo-2-pyridinyl]acetate |
| SMILES | CCc1c(C(F)F)cc(CC(=O)[O-])nc1I |
| InChI | InChI=1S/C10H10F2INO2/c1-2-6-7(9(11)12)3-5(4-8(15)16)14-10(6)13/h3,9H,2,4H2,1H3,(H,15,16)/p-1 |
| InChIKey | KCABWMZRZAVREP-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|