C17H17F3N6O4S2 — CID 171924554
N-[[4-(4-methylthiadiazole-5-carbonyl)morpholin-3-yl]methyl]-5-[N-(2,2,2-trifluoroacetyl)carbamimidoyl]thiophene-2-carboxamide (PubChem CID 171924554) has the molecular formula C17H17F3N6O4S2 and a molecular weight of 490.49 g/mol. Its IUPAC name is N-[[4-(4-methylthiadiazole-5-carbonyl)morpholin-3-yl]methyl]-5-[N-(2,2,2-trifluoroacetyl)carbamimidoyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(4-methylthiadiazole-5-carbonyl)morpholin-3-yl]methyl]-5-[N-(2,2,2-trifluoroacetyl)carbamimidoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 171924554 |
| Molecular Formula | C17H17F3N6O4S2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | N-[[4-(4-methylthiadiazole-5-carbonyl)morpholin-3-yl]methyl]-5-[N-(2,2,2-trifluoroacetyl)carbamimidoyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(\NC(=O)C(F)(F)F)c1ccc(C(=O)NCC2COCCN2C(=O)c2snnc2C)s1 |
| InChI | InChI=1S/C17H17F3N6O4S2/c1-8-12(32-25-24-8)15(28)26-4-5-30-7-9(26)6-22-14(27)11-3-2-10(31-11)13(21)23-16(29)17(18,19)20/h2-3,9H,4-7H2,1H3,(H,22,27)(H2,21,23,29) |
| InChIKey | VIZAFJKHUCYMSU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|