C15H13ClF5N5O — CID 171925529
1-(2-chloro-2,2-difluoroethanimidoyl)-5-[6-(1,1,1-trifluoro-2-methylpropan-2-yl)oxy-3-pyridinyl]pyrazin-2-imine (PubChem CID 171925529) has the molecular formula C15H13ClF5N5O and a molecular weight of 409.75 g/mol. Its IUPAC name is 1-(2-chloro-2,2-difluoroethanimidoyl)-5-[6-(1,1,1-trifluoro-2-methylpropan-2-yl)oxy-3-pyridinyl]pyrazin-2-imine.
| Compound Name | 1-(2-chloro-2,2-difluoroethanimidoyl)-5-[6-(1,1,1-trifluoro-2-methylpropan-2-yl)oxy-3-pyridinyl]pyrazin-2-imine |
|---|---|
| PubChem CID | 171925529 |
| Molecular Formula | C15H13ClF5N5O |
| Molecular Weight | 409.75 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1-(2-chloro-2,2-difluoroethanimidoyl)-5-[6-(1,1,1-trifluoro-2-methylpropan-2-yl)oxy-3-pyridinyl]pyrazin-2-imine |
| SMILES | [H]/N=C(/n1cc(-c2ccc(OC(C)(C)C(F)(F)F)nc2)nc/c1=N\[H])C(F)(F)Cl |
| InChI | InChI=1S/C15H13ClF5N5O/c1-13(2,15(19,20)21)27-11-4-3-8(5-25-11)9-7-26(10(22)6-24-9)12(23)14(16,17)18/h3-7,22-23H,1-2H3/b22-10+,23-12+ |
| InChIKey | YGSJYHMKANDFFZ-NJZYOKEHSA-N |
| XLogP | 3.80 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|