C11H15F4NO3S2 — CID 171928760
N-[(4-fluorophenyl)methyl]-1-methylsulfanylethanamine;trifluoromethanesulfonic acid (PubChem CID 171928760) has the molecular formula C11H15F4NO3S2 and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-methylsulfanylethanamine;trifluoromethanesulfonic acid.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-methylsulfanylethanamine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171928760 |
| Molecular Formula | C11H15F4NO3S2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-methylsulfanylethanamine;trifluoromethanesulfonic acid |
| SMILES | CSC(C)NCc1ccc(F)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H14FNS.CHF3O3S/c1-8(13-2)12-7-9-3-5-10(11)6-4-9;2-1(3,4)8(5,6)7/h3-6,8,12H,7H2,1-2H3;(H,5,6,7) |
| InChIKey | YDLGPZFJNKRLBX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|