C21H18F9N3O6 — CID 171930495
bis(2,2,2-trifluoroacetic acid);2,2,2-trifluoro-1-[6-(4-morpholin-4-ylanilino)-3-pyridinyl]ethanone (PubChem CID 171930495) has the molecular formula C21H18F9N3O6 and a molecular weight of 579.37 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);2,2,2-trifluoro-1-[6-(4-morpholin-4-ylanilino)-3-pyridinyl]ethanone.
| Compound Name | bis(2,2,2-trifluoroacetic acid);2,2,2-trifluoro-1-[6-(4-morpholin-4-ylanilino)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 171930495 |
| Molecular Formula | C21H18F9N3O6 |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);2,2,2-trifluoro-1-[6-(4-morpholin-4-ylanilino)-3-pyridinyl]ethanone |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(c1ccc(Nc2ccc(N3CCOCC3)cc2)nc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3N3O2.2C2HF3O2/c18-17(19,20)16(24)12-1-6-15(21-11-12)22-13-2-4-14(5-3-13)23-7-9-25-10-8-23;2*3-2(4,5)1(6)7/h1-6,11H,7-10H2,(H,21,22);2*(H,6,7) |
| InChIKey | GEUOIKNZNYWUDR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|