C26H30F3N9O2 — CID 171931700
N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-3-[[6-(4-methylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-4-yl]amino]-4-(trifluoromethyl)benzamide (PubChem CID 171931700) has the molecular formula C26H30F3N9O2 and a molecular weight of 557.58 g/mol. Its IUPAC name is N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-3-[[6-(4-methylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-4-yl]amino]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-3-[[6-(4-methylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-4-yl]amino]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171931700 |
| Molecular Formula | C26H30F3N9O2 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-3-[[6-(4-methylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-4-yl]amino]-4-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\C=C(/O)C(C)(C)C)NC(=O)c1ccc(C(F)(F)F)c(Nc2ncnc3cnc(N4CCN(C)CC4)nc23)c1 |
| InChI | InChI=1S/C26H30F3N9O2/c1-25(2,3)19(39)12-20(30)35-23(40)15-5-6-16(26(27,28)29)17(11-15)34-22-21-18(32-14-33-22)13-31-24(36-21)38-9-7-37(4)8-10-38/h5-6,11-14,39H,7-10H2,1-4H3,(H2,30,35,40)(H,32,33,34)/b19-12- |
| InChIKey | JZMYRZJDYOVHAM-UNOMPAQXSA-N |
| XLogP | 4.13 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|