C32H30F2N7O4S+ — CID 171935196
1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate (PubChem CID 171935196) has the molecular formula C32H30F2N7O4S+ and a molecular weight of 646.70 g/mol. Its IUPAC name is 1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate.
| Compound Name | 1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171935196 |
| Molecular Formula | C32H30F2N7O4S+ |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate |
| SMILES | CC(OC(=O)N(C)c1ncccc1CO)[n+]1cnn(C[C@](O)(c2cc(F)ccc2F)[C@@H](C)c2nc(-c3ccc(C#N)cc3)cs2)c1 |
| InChI | InChI=1S/C32H30F2N7O4S/c1-20(30-38-28(16-46-30)23-8-6-22(14-35)7-9-23)32(44,26-13-25(33)10-11-27(26)34)17-41-19-40(18-37-41)21(2)45-31(43)39(3)29-24(15-42)5-4-12-36-29/h4-13,16,18-21,42,44H,15,17H2,1-3H3/q+1/t20-,21?,32+/m0/s1 |
| InChIKey | MJWSCYYSSOVPSI-PKOUYPBPSA-N |
| XLogP | 4.81 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|