C32H30F2IN7O4S — CID 175673820
1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate iodide (PubChem CID 175673820) has the molecular formula C32H30F2IN7O4S and a molecular weight of 773.60 g/mol. Its IUPAC name is 1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate iodide.
| Compound Name | 1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate iodide |
|---|---|
| PubChem CID | 175673820 |
| Molecular Formula | C32H30F2IN7O4S |
| Molecular Weight | 773.60 g/mol |
| Exact Mass | 773.11 |
| IUPAC Name | 1-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethyl N-[3-(hydroxymethyl)-2-pyridinyl]-N-methylcarbamate iodide |
| SMILES | CC(OC(=O)N(C)c1ncccc1CO)[n+]1cnn(C[C@](O)(c2cc(F)ccc2F)[C@@H](C)c2nc(-c3ccc(C#N)cc3)cs2)c1.[I-] |
| InChI | InChI=1S/C32H30F2N7O4S.HI/c1-20(30-38-28(16-46-30)23-8-6-22(14-35)7-9-23)32(44,26-13-25(33)10-11-27(26)34)17-41-19-40(18-37-41)21(2)45-31(43)39(3)29-24(15-42)5-4-12-36-29;/h4-13,16,18-21,42,44H,15,17H2,1-3H3;1H/q+1;/p-1/t20-,21?,32+;/m0./s1 |
| InChIKey | LVHYVTGAGYOSHJ-WJVMXJECSA-M |
| XLogP | 1.82 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.60 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|