C29H35NO4 — CID 171937913
9H-fluoren-9-ylmethyl 7-(5-methylhexanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171937913) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 7-(5-methylhexanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 7-(5-methylhexanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171937913 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 7-(5-methylhexanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)CCCC(=O)C1CC2COCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H35NO4/c1-19(2)8-7-13-28(31)20-14-21-16-33-17-22(15-20)30(21)29(32)34-18-27-25-11-5-3-9-23(25)24-10-4-6-12-26(24)27/h3-6,9-12,19-22,27H,7-8,13-18H2,1-2H3 |
| InChIKey | ZBBYIQPUQLXHGO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |