C30H24F5NO4 — CID 171943042
9H-fluoren-9-ylmethyl 7-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171943042) has the molecular formula C30H24F5NO4 and a molecular weight of 557.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 7-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 7-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171943042 |
| Molecular Formula | C30H24F5NO4 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 7-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)C1CC2COCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H24F5NO4/c31-25-22(26(32)28(34)29(35)27(25)33)11-24(37)15-9-16-12-39-13-17(10-15)36(16)30(38)40-14-23-20-7-3-1-5-18(20)19-6-2-4-8-21(19)23/h1-8,15-17,23H,9-14H2 |
| InChIKey | NCICLLQNCDMTDN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|