C21H27NO4 — CID 171938643
benzyl 7-(4-methylpent-3-enoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171938643) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is benzyl 7-(4-methylpent-3-enoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-(4-methylpent-3-enoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171938643 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | benzyl 7-(4-methylpent-3-enoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)=CCC(=O)C1CC2COCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO4/c1-15(2)8-9-20(23)17-10-18-13-25-14-19(11-17)22(18)21(24)26-12-16-6-4-3-5-7-16/h3-8,17-19H,9-14H2,1-2H3 |
| InChIKey | WPEUAGAOYNFYNP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|