C21H29NO6 — CID 171950058
benzyl 7-(4,4-dimethoxybutanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171950058) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is benzyl 7-(4,4-dimethoxybutanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-(4,4-dimethoxybutanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171950058 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | benzyl 7-(4,4-dimethoxybutanoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COC(CCC(=O)C1CC2COCC(C1)N2C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C21H29NO6/c1-25-20(26-2)9-8-19(23)16-10-17-13-27-14-18(11-16)22(17)21(24)28-12-15-6-4-3-5-7-15/h3-7,16-18,20H,8-14H2,1-2H3 |
| InChIKey | FQNKQIKJCPIBOK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|