C16H20FNO2 — CID 171940818
1-(8-azabicyclo[3.2.1]octan-3-yl)-2-(5-fluoro-2-methoxyphenyl)ethanone (PubChem CID 171940818) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-(8-azabicyclo[3.2.1]octan-3-yl)-2-(5-fluoro-2-methoxyphenyl)ethanone.
| Compound Name | 1-(8-azabicyclo[3.2.1]octan-3-yl)-2-(5-fluoro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 171940818 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-(8-azabicyclo[3.2.1]octan-3-yl)-2-(5-fluoro-2-methoxyphenyl)ethanone |
| SMILES | COc1ccc(F)cc1CC(=O)C1CC2CCC(C1)N2 |
| InChI | InChI=1S/C16H20FNO2/c1-20-16-5-2-12(17)6-11(16)9-15(19)10-7-13-3-4-14(8-10)18-13/h2,5-6,10,13-14,18H,3-4,7-9H2,1H3 |
| InChIKey | BLFVPGRIELHUAK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |