C17H21FO3S — CID 171940884
2-(3-fluoro-5-methoxyphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone (PubChem CID 171940884) has the molecular formula C17H21FO3S and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(3-fluoro-5-methoxyphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone.
| Compound Name | 2-(3-fluoro-5-methoxyphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone |
|---|---|
| PubChem CID | 171940884 |
| Molecular Formula | C17H21FO3S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-(3-fluoro-5-methoxyphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone |
| SMILES | COc1cc(F)cc(CC(=O)C2CC3CCCC(C2)S3=O)c1 |
| InChI | InChI=1S/C17H21FO3S/c1-21-14-6-11(5-13(18)10-14)7-17(19)12-8-15-3-2-4-16(9-12)22(15)20/h5-6,10,12,15-16H,2-4,7-9H2,1H3 |
| InChIKey | KBQFTTVGEOEOKG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |