C16H17F3O3S — CID 171941403
1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-2-(2,4,5-trifluorophenyl)ethanone (PubChem CID 171941403) has the molecular formula C16H17F3O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-2-(2,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-2-(2,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 171941403 |
| Molecular Formula | C16H17F3O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-2-(2,4,5-trifluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)c(F)cc1F)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C16H17F3O3S/c17-13-8-15(19)14(18)6-9(13)7-16(20)10-4-11-2-1-3-12(5-10)23(11,21)22/h6,8,10-12H,1-5,7H2 |
| InChIKey | OLUZMRORHWCDIQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|