C14H23FO3S — CID 171938031
1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-6-fluorohexan-1-one (PubChem CID 171938031) has the molecular formula C14H23FO3S and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-6-fluorohexan-1-one.
| Compound Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-6-fluorohexan-1-one |
|---|---|
| PubChem CID | 171938031 |
| Molecular Formula | C14H23FO3S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-6-fluorohexan-1-one |
| SMILES | O=C(CCCCCF)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C14H23FO3S/c15-8-3-1-2-7-14(16)11-9-12-5-4-6-13(10-11)19(12,17)18/h11-13H,1-10H2 |
| InChIKey | RPYAKAMNLVCDRM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|