C13H21FO3S — CID 171938022
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-6-fluorohexan-1-one (PubChem CID 171938022) has the molecular formula C13H21FO3S and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-6-fluorohexan-1-one.
| Compound Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-6-fluorohexan-1-one |
|---|---|
| PubChem CID | 171938022 |
| Molecular Formula | C13H21FO3S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-6-fluorohexan-1-one |
| SMILES | O=C(CCCCCF)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C13H21FO3S/c14-7-3-1-2-4-13(15)10-8-11-5-6-12(9-10)18(11,16)17/h10-12H,1-9H2 |
| InChIKey | LIPQDJXEBQSNKB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|