C14H22O3SSi — CID 171950116
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-4-trimethylsilylbut-3-yn-1-one (PubChem CID 171950116) has the molecular formula C14H22O3SSi and a molecular weight of 298.48 g/mol. Its IUPAC name is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-4-trimethylsilylbut-3-yn-1-one.
| Compound Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-4-trimethylsilylbut-3-yn-1-one |
|---|---|
| PubChem CID | 171950116 |
| Molecular Formula | C14H22O3SSi |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-4-trimethylsilylbut-3-yn-1-one |
| SMILES | C[Si](C)(C)C#CCC(=O)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C14H22O3SSi/c1-19(2,3)8-4-5-14(15)11-9-12-6-7-13(10-11)18(12,16)17/h11-13H,5-7,9-10H2,1-3H3 |
| InChIKey | ACJBHUDFXWKIRM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|