C26H27BrN2O3 — CID 17194642
5-bromo-N-[3-(diethylcarbamoyl)phenyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17194642) has the molecular formula C26H27BrN2O3 and a molecular weight of 495.42 g/mol. Its IUPAC name is 5-bromo-N-[3-(diethylcarbamoyl)phenyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[3-(diethylcarbamoyl)phenyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17194642 |
| Molecular Formula | C26H27BrN2O3 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 5-bromo-N-[3-(diethylcarbamoyl)phenyl]-2-(2-phenylethoxy)benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cc(Br)ccc2OCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H27BrN2O3/c1-3-29(4-2)26(31)20-11-8-12-22(17-20)28-25(30)23-18-21(27)13-14-24(23)32-16-15-19-9-6-5-7-10-19/h5-14,17-18H,3-4,15-16H2,1-2H3,(H,28,30) |
| InChIKey | UZCCNEOOZIAZLQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |