C25H25BrN2O3 — CID 17227864
5-bromo-2-butoxy-N-[3-[methyl(phenyl)carbamoyl]phenyl]benzamide (PubChem CID 17227864) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[3-[methyl(phenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[3-[methyl(phenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17227864 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 5-bromo-2-butoxy-N-[3-[methyl(phenyl)carbamoyl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)Nc1cccc(C(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H25BrN2O3/c1-3-4-15-31-23-14-13-19(26)17-22(23)24(29)27-20-10-8-9-18(16-20)25(30)28(2)21-11-6-5-7-12-21/h5-14,16-17H,3-4,15H2,1-2H3,(H,27,29) |
| InChIKey | WNZXSUNFAPMXCL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|