C22H25BrN2O3 — CID 26161701
5-bromo-2-butoxy-N-[3-(pyrrolidine-1-carbonyl)phenyl]benzamide (PubChem CID 26161701) has the molecular formula C22H25BrN2O3 and a molecular weight of 445.36 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[3-(pyrrolidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[3-(pyrrolidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26161701 |
| Molecular Formula | C22H25BrN2O3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 5-bromo-2-butoxy-N-[3-(pyrrolidine-1-carbonyl)phenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)Nc1cccc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H25BrN2O3/c1-2-3-13-28-20-10-9-17(23)15-19(20)21(26)24-18-8-6-7-16(14-18)22(27)25-11-4-5-12-25/h6-10,14-15H,2-5,11-13H2,1H3,(H,24,26) |
| InChIKey | PBFVLKQKOWRLTF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|