C32H30N2O3 — CID 171946447
9H-fluoren-9-ylmethyl 3-[2-(3-cyanophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171946447) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[2-(3-cyanophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[2-(3-cyanophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171946447 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[2-(3-cyanophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | N#Cc1cccc(CC(=O)C2CC3CCCC(C2)N3C(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C32H30N2O3/c33-19-22-8-5-7-21(15-22)16-31(35)23-17-24-9-6-10-25(18-23)34(24)32(36)37-20-30-28-13-3-1-11-26(28)27-12-2-4-14-29(27)30/h1-5,7-8,11-15,23-25,30H,6,9-10,16-18,20H2 |
| InChIKey | UDMAIDJFTGTTNU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |