About [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone
[2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171947736) has the molecular formula C16H18F2O3S
and a molecular weight of 328.38 g/mol. Its IUPAC name is [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone.
Molecular Properties
| Compound Name | [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| PubChem CID | 171947736 |
| Molecular Formula | C16H18F2O3S |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(c1ccccc1C(F)F)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C16H18F2O3S/c17-16(18)14-7-2-1-6-13(14)15(19)10-8-11-4-3-5-12(9-10)22(11,20)21/h1-2,6-7,10-12,16H,3-5,8-9H2 |
| InChIKey | FBPIWUAIYPRGEE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The IUPAC name of [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone (CID 171947736) is [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone.
What is the SMILES notation for [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The canonical SMILES for [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone is O=C(c1ccccc1C(F)F)C1CC2CCCC(C1)S2(=O)=O.
What is the InChIKey of [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The InChIKey is FBPIWUAIYPRGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2O3S/c17-16(18)14-7-2-1-6-13(14)15(19)10-8-11-4-3-5-12(9-10)22(11,20)21/h1-2,6-7,10-12,16H,3-5,8-9H2.
What are the key properties of [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
[2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone has a molecular weight of 328.38 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(difluoromethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone is sourced from PubChem (CID 171947736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).