About (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone
(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone (PubChem CID 171939042) has the molecular formula C23H22O3S
and a molecular weight of 378.49 g/mol. Its IUPAC name is (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone.
Molecular Properties
| Compound Name | (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone |
| PubChem CID | 171939042 |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone |
| SMILES | O=C(c1cc2ccccc2c2ccccc12)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C23H22O3S/c24-23(16-12-17-7-5-8-18(13-16)27(17,25)26)22-14-15-6-1-2-9-19(15)20-10-3-4-11-21(20)22/h1-4,6,9-11,14,16-18H,5,7-8,12-13H2 |
| InChIKey | SFYYJQUAOAHEMR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone?
The IUPAC name of (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone (CID 171939042) is (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone.
What is the SMILES notation for (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone?
The canonical SMILES for (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone is O=C(c1cc2ccccc2c2ccccc12)C1CC2CCCC(C1)S2(=O)=O.
What is the InChIKey of (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone?
The InChIKey is SFYYJQUAOAHEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O3S/c24-23(16-12-17-7-5-8-18(13-16)27(17,25)26)22-14-15-6-1-2-9-19(15)20-10-3-4-11-21(20)22/h1-4,6,9-11,14,16-18H,5,7-8,12-13H2.
What are the key properties of (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone?
(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone has a molecular weight of 378.49 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-phenanthren-9-ylmethanone is sourced from PubChem (CID 171939042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).