C16H17F4NO — CID 171949519
9-azabicyclo[3.3.1]nonan-3-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 171949519) has the molecular formula C16H17F4NO and a molecular weight of 315.31 g/mol. Its IUPAC name is 9-azabicyclo[3.3.1]nonan-3-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | 9-azabicyclo[3.3.1]nonan-3-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 171949519 |
| Molecular Formula | C16H17F4NO |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 9-azabicyclo[3.3.1]nonan-3-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)ccc1F)C1CC2CCCC(C1)N2 |
| InChI | InChI=1S/C16H17F4NO/c17-14-5-4-10(16(18,19)20)8-13(14)15(22)9-6-11-2-1-3-12(7-9)21-11/h4-5,8-9,11-12,21H,1-3,6-7H2 |
| InChIKey | GCZWWEITSLOJEC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |