C15H15F4NO — CID 171941147
9-azabicyclo[3.3.1]nonan-3-yl-(2,3,5,6-tetrafluorophenyl)methanone (PubChem CID 171941147) has the molecular formula C15H15F4NO and a molecular weight of 301.28 g/mol. Its IUPAC name is 9-azabicyclo[3.3.1]nonan-3-yl-(2,3,5,6-tetrafluorophenyl)methanone.
| Compound Name | 9-azabicyclo[3.3.1]nonan-3-yl-(2,3,5,6-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 171941147 |
| Molecular Formula | C15H15F4NO |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 9-azabicyclo[3.3.1]nonan-3-yl-(2,3,5,6-tetrafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)cc(F)c1F)C1CC2CCCC(C1)N2 |
| InChI | InChI=1S/C15H15F4NO/c16-10-6-11(17)14(19)12(13(10)18)15(21)7-4-8-2-1-3-9(5-7)20-8/h6-9,20H,1-5H2 |
| InChIKey | KBAROYIBWNYEML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|