C19H20F5NO3 — CID 171949736
tert-butyl 3-(2,3,4,5,6-pentafluorobenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171949736) has the molecular formula C19H20F5NO3 and a molecular weight of 405.36 g/mol. Its IUPAC name is tert-butyl 3-(2,3,4,5,6-pentafluorobenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-(2,3,4,5,6-pentafluorobenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171949736 |
| Molecular Formula | C19H20F5NO3 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | tert-butyl 3-(2,3,4,5,6-pentafluorobenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(C(=O)c1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C19H20F5NO3/c1-19(2,3)28-18(27)25-9-4-5-10(25)7-8(6-9)17(26)11-12(20)14(22)16(24)15(23)13(11)21/h8-10H,4-7H2,1-3H3 |
| InChIKey | AWZJZSXWDUGGLL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|