C15H19FN2O — CID 171950538
(6-fluoro-2-pyridinyl)-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171950538) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is (6-fluoro-2-pyridinyl)-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | (6-fluoro-2-pyridinyl)-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171950538 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (6-fluoro-2-pyridinyl)-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | CN1C2CCCC1CC(C(=O)c1cccc(F)n1)C2 |
| InChI | InChI=1S/C15H19FN2O/c1-18-11-4-2-5-12(18)9-10(8-11)15(19)13-6-3-7-14(16)17-13/h3,6-7,10-12H,2,4-5,8-9H2,1H3 |
| InChIKey | WUXAJDBTMCVFRA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|