C13H14FNO3S — CID 171950536
(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(6-fluoro-2-pyridinyl)methanone (PubChem CID 171950536) has the molecular formula C13H14FNO3S and a molecular weight of 283.32 g/mol. Its IUPAC name is (8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(6-fluoro-2-pyridinyl)methanone.
| Compound Name | (8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(6-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 171950536 |
| Molecular Formula | C13H14FNO3S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(6-fluoro-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(F)n1)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C13H14FNO3S/c14-12-3-1-2-11(15-12)13(16)8-6-9-4-5-10(7-8)19(9,17)18/h1-3,8-10H,4-7H2 |
| InChIKey | YLOIKBYNHUZFDW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|