C14H11F5O3S — CID 171949743
(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 171949743) has the molecular formula C14H11F5O3S and a molecular weight of 354.30 g/mol. Its IUPAC name is (8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | (8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 171949743 |
| Molecular Formula | C14H11F5O3S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | (8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C14H11F5O3S/c15-9-8(10(16)12(18)13(19)11(9)17)14(20)5-3-6-1-2-7(4-5)23(6,21)22/h5-7H,1-4H2 |
| InChIKey | WEGPWBGXVKCZGX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|