C12H14FNO3S — CID 171964703
3-(6-fluoro-2-pyridinyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171964703) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-(6-fluoro-2-pyridinyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(6-fluoro-2-pyridinyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171964703 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-(6-fluoro-2-pyridinyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(c1cccc(F)n1)C2 |
| InChI | InChI=1S/C12H14FNO3S/c13-11-3-1-2-10(14-11)12(15)6-8-4-5-9(7-12)18(8,16)17/h1-3,8-9,15H,4-7H2 |
| InChIKey | SQFVHEPHNJJQDK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|