C26H25N3O3 — CID 171951815
9H-fluoren-9-ylmethyl 3-hydroxy-3-pyrimidin-2-yl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171951815) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-hydroxy-3-pyrimidin-2-yl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-hydroxy-3-pyrimidin-2-yl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171951815 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-hydroxy-3-pyrimidin-2-yl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1C2CCC1CC(O)(c1ncccn1)C2 |
| InChI | InChI=1S/C26H25N3O3/c30-25(29-17-10-11-18(29)15-26(31,14-17)24-27-12-5-13-28-24)32-16-23-21-8-3-1-6-19(21)20-7-2-4-9-22(20)23/h1-9,12-13,17-18,23,31H,10-11,14-16H2 |
| InChIKey | ALPPIIXRTNCJTF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |