C30H31NO3 — CID 171958867
9H-fluoren-9-ylmethyl 3-(4-ethylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171958867) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-(4-ethylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-(4-ethylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171958867 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-(4-ethylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCc1ccc(C2(O)CC3CCC(C2)N3C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H31NO3/c1-2-20-11-13-21(14-12-20)30(33)17-22-15-16-23(18-30)31(22)29(32)34-19-28-26-9-5-3-7-24(26)25-8-4-6-10-27(25)28/h3-14,22-23,28,33H,2,15-19H2,1H3 |
| InChIKey | GUZYRSTVHVXRJQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |