C11H16F3NO — CID 171952294
8-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171952294) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 8-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171952294 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 8-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C=C(C(F)(F)F)C1(O)CC2CCC(C1)N2C |
| InChI | InChI=1S/C11H16F3NO/c1-7(11(12,13)14)10(16)5-8-3-4-9(6-10)15(8)2/h8-9,16H,1,3-6H2,2H3 |
| InChIKey | YDORZZPBSYCDAQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|