C12H18F3NO — CID 171952304
9-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171952304) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is 9-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171952304 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 9-methyl-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | C=C(C(F)(F)F)C1(O)CC2CCCC(C1)N2C |
| InChI | InChI=1S/C12H18F3NO/c1-8(12(13,14)15)11(17)6-9-4-3-5-10(7-11)16(9)2/h9-10,17H,1,3-7H2,2H3 |
| InChIKey | CFWUGEOGWAHHMH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|