C10H16F3NO — CID 171951291
9-methyl-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171951291) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 9-methyl-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-methyl-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171951291 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 9-methyl-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | CN1C2CCCC1CC(O)(C(F)(F)F)C2 |
| InChI | InChI=1S/C10H16F3NO/c1-14-7-3-2-4-8(14)6-9(15,5-7)10(11,12)13/h7-8,15H,2-6H2,1H3 |
| InChIKey | LVUIYTPJBXFFPG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |