C9H14F3NO — CID 98113068
(1R,5R)-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 98113068) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is (1R,5R)-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | (1R,5R)-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 98113068 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (1R,5R)-3-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | OC1(C(F)(F)F)C[C@H]2CCC[C@H](C1)N2 |
| InChI | InChI=1S/C9H14F3NO/c10-9(11,12)8(14)4-6-2-1-3-7(5-8)13-6/h6-7,13-14H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | CIKUVALPELDGLU-RNFRBKRXSA-N |
| XLogP | 1.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |