C16H24F3NO3 — CID 171952306
tert-butyl 3-hydroxy-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171952306) has the molecular formula C16H24F3NO3 and a molecular weight of 335.37 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171952306 |
| Molecular Formula | C16H24F3NO3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(3,3,3-trifluoroprop-1-en-2-yl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C=C(C(F)(F)F)C1(O)CC2CCCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24F3NO3/c1-10(16(17,18)19)15(22)8-11-6-5-7-12(9-15)20(11)13(21)23-14(2,3)4/h11-12,22H,1,5-9H2,2-4H3 |
| InChIKey | VAKKRUSFXSUSTL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|