C17H20F3NO2 — CID 171952314
9-benzyl-7-(3,3,3-trifluoroprop-1-en-2-yl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (PubChem CID 171952314) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 9-benzyl-7-(3,3,3-trifluoroprop-1-en-2-yl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
| Compound Name | 9-benzyl-7-(3,3,3-trifluoroprop-1-en-2-yl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 171952314 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 9-benzyl-7-(3,3,3-trifluoroprop-1-en-2-yl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| SMILES | C=C(C(F)(F)F)C1(O)CC2COCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H20F3NO2/c1-12(17(18,19)20)16(22)7-14-10-23-11-15(8-16)21(14)9-13-5-3-2-4-6-13/h2-6,14-15,22H,1,7-11H2 |
| InChIKey | LLRSSZFDPSBNTC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|