C16H27NO3 — CID 171952535
tert-butyl 3-hydroxy-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171952535) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171952535 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)=CC1(O)CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO3/c1-11(2)8-16(19)9-12-6-7-13(10-16)17(12)14(18)20-15(3,4)5/h8,12-13,19H,6-7,9-10H2,1-5H3 |
| InChIKey | SLZATFLMXSHCFD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|